About (7R)-7-methyl-6,7-dihydroquinazoline
(7R)-7-methyl-6,7-dihydroquinazoline (PubChem CID 89097060) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is (7R)-7-methyl-6,7-dihydroquinazoline.
Molecular Properties
| Compound Name | (7R)-7-methyl-6,7-dihydroquinazoline |
| PubChem CID | 89097060 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | (7R)-7-methyl-6,7-dihydroquinazoline |
| SMILES | C[C@H]1C=c2ncncc2=CC1 |
| InChI | InChI=1S/C9H10N2/c1-7-2-3-8-5-10-6-11-9(8)4-7/h3-7H,2H2,1H3/t7-/m1/s1 |
| InChIKey | CCPUWZBVBJBAOB-SSDOTTSWSA-N |
| XLogP | 0.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7R)-7-methyl-6,7-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-7-methyl-6,7-dihydroquinazoline?
The IUPAC name of (7R)-7-methyl-6,7-dihydroquinazoline (CID 89097060) is (7R)-7-methyl-6,7-dihydroquinazoline.
What is the SMILES notation for (7R)-7-methyl-6,7-dihydroquinazoline?
The canonical SMILES for (7R)-7-methyl-6,7-dihydroquinazoline is C[C@H]1C=c2ncncc2=CC1.
What is the InChIKey of (7R)-7-methyl-6,7-dihydroquinazoline?
The InChIKey is CCPUWZBVBJBAOB-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-2-3-8-5-10-6-11-9(8)4-7/h3-7H,2H2,1H3/t7-/m1/s1.
What are the key properties of (7R)-7-methyl-6,7-dihydroquinazoline?
(7R)-7-methyl-6,7-dihydroquinazoline has a molecular weight of 146.19 g/mol, XLogP of 0.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-methyl-6,7-dihydroquinazoline is sourced from PubChem (CID 89097060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).