C14H20FN3OS — CID 89097517
2-[(4S)-2-amino-4-(5-amino-2-fluorophenyl)-4-methyl-5,6-dihydro-1,3-thiazin-6-yl]propan-2-ol (PubChem CID 89097517) has the molecular formula C14H20FN3OS and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[(4S)-2-amino-4-(5-amino-2-fluorophenyl)-4-methyl-5,6-dihydro-1,3-thiazin-6-yl]propan-2-ol.
| Compound Name | 2-[(4S)-2-amino-4-(5-amino-2-fluorophenyl)-4-methyl-5,6-dihydro-1,3-thiazin-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 89097517 |
| Molecular Formula | C14H20FN3OS |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[(4S)-2-amino-4-(5-amino-2-fluorophenyl)-4-methyl-5,6-dihydro-1,3-thiazin-6-yl]propan-2-ol |
| SMILES | CC(C)(O)C1C[C@@](C)(c2cc(N)ccc2F)N=C(N)S1 |
| InChI | InChI=1S/C14H20FN3OS/c1-13(2,19)11-7-14(3,18-12(17)20-11)9-6-8(16)4-5-10(9)15/h4-6,11,19H,7,16H2,1-3H3,(H2,17,18)/t11?,14-/m0/s1 |
| InChIKey | SYZJUQPFSIASDD-IAXJKZSUSA-N |
| XLogP | 2.21 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|