About (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine
(4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine (PubChem CID 89097539) has the molecular formula C14H17F2N3S
and a molecular weight of 297.37 g/mol. Its IUPAC name is (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine |
| PubChem CID | 89097539 |
| Molecular Formula | C14H17F2N3S |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine |
| SMILES | CC(C)(F)C1=C[C@@](C)(c2cc(N)ccc2F)N=C(N)S1 |
| InChI | InChI=1S/C14H17F2N3S/c1-13(2,16)11-7-14(3,19-12(18)20-11)9-6-8(17)4-5-10(9)15/h4-7H,17H2,1-3H3,(H2,18,19)/t14-/m0/s1 |
| InChIKey | XUWLQZOQDQUCGF-AWEZNQCLSA-N |
| XLogP | 3.32 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine?
The IUPAC name of (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine (CID 89097539) is (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine.
What is the SMILES notation for (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine?
The canonical SMILES for (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine is CC(C)(F)C1=C[C@@](C)(c2cc(N)ccc2F)N=C(N)S1.
What is the InChIKey of (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine?
The InChIKey is XUWLQZOQDQUCGF-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H17F2N3S/c1-13(2,16)11-7-14(3,19-12(18)20-11)9-6-8(17)4-5-10(9)15/h4-7H,17H2,1-3H3,(H2,18,19)/t14-/m0/s1.
What are the key properties of (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine?
(4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine has a molecular weight of 297.37 g/mol, XLogP of 3.32, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(5-amino-2-fluorophenyl)-6-(2-fluoropropan-2-yl)-4-methyl-1,3-thiazin-2-amine is sourced from PubChem (CID 89097539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).