C19H29N3O2 — CID 89097610
7-[(3E,5Z)-4-but-3-enyl-3-methylocta-3,5-dienyl]-2,5,8,8a-tetrahydro-1H-imidazo[1,2-a]pyrazine-3,6-dione (PubChem CID 89097610) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 7-[(3E,5Z)-4-but-3-enyl-3-methylocta-3,5-dienyl]-2,5,8,8a-tetrahydro-1H-imidazo[1,2-a]pyrazine-3,6-dione.
| Compound Name | 7-[(3E,5Z)-4-but-3-enyl-3-methylocta-3,5-dienyl]-2,5,8,8a-tetrahydro-1H-imidazo[1,2-a]pyrazine-3,6-dione |
|---|---|
| PubChem CID | 89097610 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 7-[(3E,5Z)-4-but-3-enyl-3-methylocta-3,5-dienyl]-2,5,8,8a-tetrahydro-1H-imidazo[1,2-a]pyrazine-3,6-dione |
| SMILES | C=CCCC(/C=C\CC)=C(/C)CCN1CC2NCC(=O)N2CC1=O |
| InChI | InChI=1S/C19H29N3O2/c1-4-6-8-16(9-7-5-2)15(3)10-11-21-13-17-20-12-18(23)22(17)14-19(21)24/h4,7,9,17,20H,1,5-6,8,10-14H2,2-3H3/b9-7-,16-15+ |
| InChIKey | SZRMVEMFBSJMJO-CVYCBILFSA-N |
| XLogP | 2.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|