C8H16O7S — CID 89097680
methyl 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]ethanesulfonate (PubChem CID 89097680) has the molecular formula C8H16O7S and a molecular weight of 256.28 g/mol. Its IUPAC name is methyl 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]ethanesulfonate.
| Compound Name | methyl 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 89097680 |
| Molecular Formula | C8H16O7S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | methyl 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]ethanesulfonate |
| SMILES | CO[C@@H]1O[C@H](CCS(=O)(=O)OC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H16O7S/c1-13-8-7(10)6(9)5(15-8)3-4-16(11,12)14-2/h5-10H,3-4H2,1-2H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | LBOHWQDQFLYUJF-WCTZXXKLSA-N |
| XLogP | -1.55 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|