C16H14F6N2O2 — CID 89097762
1-(3-methyl-4-nitrophenyl)-N-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]propan-2-imine (PubChem CID 89097762) has the molecular formula C16H14F6N2O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 1-(3-methyl-4-nitrophenyl)-N-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]propan-2-imine.
| Compound Name | 1-(3-methyl-4-nitrophenyl)-N-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 89097762 |
| Molecular Formula | C16H14F6N2O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-(3-methyl-4-nitrophenyl)-N-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]propan-2-imine |
| SMILES | C=C(/C=C(\N=C(/C)Cc1ccc([N+](=O)[O-])c(C)c1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H14F6N2O2/c1-9-6-12(4-5-13(9)24(25)26)8-11(3)23-14(16(20,21)22)7-10(2)15(17,18)19/h4-7H,2,8H2,1,3H3/b14-7-,23-11+ |
| InChIKey | RXGKFBULNJSYLK-UZANHDLSSA-N |
| XLogP | 5.47 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|