About (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate
(2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate (PubChem CID 89097905) has the molecular formula C19H27N3O6
and a molecular weight of 393.44 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate |
| PubChem CID | 89097905 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate |
| SMILES | C=CN(CCC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O)C(=O)/C=C\C |
| InChI | InChI=1S/C19H27N3O6/c1-3-8-16(24)21(4-2)14-12-15(23)20-13-7-5-6-9-19(27)28-22-17(25)10-11-18(22)26/h3-4,8H,2,5-7,9-14H2,1H3,(H,20,23)/b8-3- |
| InChIKey | OJNWYBJXRIGWTQ-BAQGIRSFSA-N |
| XLogP | 1.21 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate (CID 89097905) is (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate is C=CN(CCC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O)C(=O)/C=C\C.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate?
The InChIKey is OJNWYBJXRIGWTQ-BAQGIRSFSA-N. The full InChI is InChI=1S/C19H27N3O6/c1-3-8-16(24)21(4-2)14-12-15(23)20-13-7-5-6-9-19(27)28-22-17(25)10-11-18(22)26/h3-4,8H,2,5-7,9-14H2,1H3,(H,20,23)/b8-3-.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate?
(2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate has a molecular weight of 393.44 g/mol, XLogP of 1.21, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 6-[3-[[(Z)-but-2-enoyl]-ethenylamino]propanoylamino]hexanoate is sourced from PubChem (CID 89097905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).