About 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole
4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole (PubChem CID 89098003) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole.
Molecular Properties
| Compound Name | 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole |
| PubChem CID | 89098003 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole |
| SMILES | CCCC1=NC2C(C)=CC=CC2N1 |
| InChI | InChI=1S/C11H16N2/c1-3-5-10-12-9-7-4-6-8(2)11(9)13-10/h4,6-7,9,11H,3,5H2,1-2H3,(H,12,13) |
| InChIKey | GLDNIRPYZMUSRR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole?
The IUPAC name of 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole (CID 89098003) is 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole.
What is the SMILES notation for 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole?
The canonical SMILES for 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole is CCCC1=NC2C(C)=CC=CC2N1.
What is the InChIKey of 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole?
The InChIKey is GLDNIRPYZMUSRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-3-5-10-12-9-7-4-6-8(2)11(9)13-10/h4,6-7,9,11H,3,5H2,1-2H3,(H,12,13).
What are the key properties of 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole?
4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole has a molecular weight of 176.26 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-propyl-3a,7a-dihydro-1H-benzimidazole is sourced from PubChem (CID 89098003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).