C30H34FNO3 — CID 89098011
tert-butyl N-[(1R)-1-(4-fluoronaphthalen-1-yl)ethyl]-N-[(1S,3R)-3-[4-(2-oxoethyl)phenyl]cyclopentyl]carbamate (PubChem CID 89098011) has the molecular formula C30H34FNO3 and a molecular weight of 475.60 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(4-fluoronaphthalen-1-yl)ethyl]-N-[(1S,3R)-3-[4-(2-oxoethyl)phenyl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(4-fluoronaphthalen-1-yl)ethyl]-N-[(1S,3R)-3-[4-(2-oxoethyl)phenyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 89098011 |
| Molecular Formula | C30H34FNO3 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | tert-butyl N-[(1R)-1-(4-fluoronaphthalen-1-yl)ethyl]-N-[(1S,3R)-3-[4-(2-oxoethyl)phenyl]cyclopentyl]carbamate |
| SMILES | C[C@H](c1ccc(F)c2ccccc12)N(C(=O)OC(C)(C)C)[C@H]1CC[C@@H](c2ccc(CC=O)cc2)C1 |
| InChI | InChI=1S/C30H34FNO3/c1-20(25-15-16-28(31)27-8-6-5-7-26(25)27)32(29(34)35-30(2,3)4)24-14-13-23(19-24)22-11-9-21(10-12-22)17-18-33/h5-12,15-16,18,20,23-24H,13-14,17,19H2,1-4H3/t20-,23-,24+/m1/s1 |
| InChIKey | QWRGJRHVSHAMSZ-HUVFLSCGSA-N |
| XLogP | 7.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|