C27H40F3N5O3 — CID 89098326
2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-[4-(4-ethylpiperazin-1-yl)cyclohexyl]amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 89098326) has the molecular formula C27H40F3N5O3 and a molecular weight of 539.64 g/mol. Its IUPAC name is 2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-[4-(4-ethylpiperazin-1-yl)cyclohexyl]amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-[4-(4-ethylpiperazin-1-yl)cyclohexyl]amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 89098326 |
| Molecular Formula | C27H40F3N5O3 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | 2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-[4-(4-ethylpiperazin-1-yl)cyclohexyl]amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | [H]/N=C(\C(=O)NCC(F)(F)F)N(C(=C)c1cc(C(C)C)c(O)cc1O)C1CCC(N2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C27H40F3N5O3/c1-5-33-10-12-34(13-11-33)19-6-8-20(9-7-19)35(25(31)26(38)32-16-27(28,29)30)18(4)22-14-21(17(2)3)23(36)15-24(22)37/h14-15,17,19-20,31,36-37H,4-13,16H2,1-3H3,(H,32,38)/b31-25+ |
| InChIKey | YCLJIAAQZMUCSL-QCKNELIISA-N |
| XLogP | 4.10 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|