C27H36FN5O3 — CID 89098339
2-[N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-N-ethyl-2-iminoacetamide (PubChem CID 89098339) has the molecular formula C27H36FN5O3 and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-[N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-N-ethyl-2-iminoacetamide.
| Compound Name | 2-[N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-N-ethyl-2-iminoacetamide |
|---|---|
| PubChem CID | 89098339 |
| Molecular Formula | C27H36FN5O3 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 2-[N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-N-ethyl-2-iminoacetamide |
| SMILES | [H]/N=C(\C(=O)NCC)N(C(=C)c1cc(C(C)C)c(O)cc1O)c1ccc(CN2CCN(C)CC2)c(F)c1 |
| InChI | InChI=1S/C27H36FN5O3/c1-6-30-27(36)26(29)33(18(4)22-14-21(17(2)3)24(34)15-25(22)35)20-8-7-19(23(28)13-20)16-32-11-9-31(5)10-12-32/h7-8,13-15,17,29,34-35H,4,6,9-12,16H2,1-3,5H3,(H,30,36)/b29-26+ |
| InChIKey | FHEXNOXGSNKDCU-PBBVDAKRSA-N |
| XLogP | 3.70 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|