C27H37FN4O3 — CID 89098340
N-[4-[[2-(diethylamino)ethyl-methylamino]methyl]-3-fluorophenyl]-N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-2-oxoethanimidamide (PubChem CID 89098340) has the molecular formula C27H37FN4O3 and a molecular weight of 484.62 g/mol. Its IUPAC name is N-[4-[[2-(diethylamino)ethyl-methylamino]methyl]-3-fluorophenyl]-N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-2-oxoethanimidamide.
| Compound Name | N-[4-[[2-(diethylamino)ethyl-methylamino]methyl]-3-fluorophenyl]-N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-2-oxoethanimidamide |
|---|---|
| PubChem CID | 89098340 |
| Molecular Formula | C27H37FN4O3 |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | N-[4-[[2-(diethylamino)ethyl-methylamino]methyl]-3-fluorophenyl]-N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-2-oxoethanimidamide |
| SMILES | [H]/N=C(\C=O)N(C(=C)c1cc(C(C)C)c(O)cc1O)c1ccc(CN(C)CCN(CC)CC)c(F)c1 |
| InChI | InChI=1S/C27H37FN4O3/c1-7-31(8-2)12-11-30(6)16-20-9-10-21(13-24(20)28)32(27(29)17-33)19(5)23-14-22(18(3)4)25(34)15-26(23)35/h9-10,13-15,17-18,29,34-35H,5,7-8,11-12,16H2,1-4,6H3/b29-27+ |
| InChIKey | XOGHMCQZCPLART-ORIPQNMZSA-N |
| XLogP | 4.79 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|