C27H33F3N4O3 — CID 89098356
2-[N-[1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethenyl]-4-(pyrrolidin-1-ylmethyl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 89098356) has the molecular formula C27H33F3N4O3 and a molecular weight of 518.58 g/mol. Its IUPAC name is 2-[N-[1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethenyl]-4-(pyrrolidin-1-ylmethyl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[N-[1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethenyl]-4-(pyrrolidin-1-ylmethyl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 89098356 |
| Molecular Formula | C27H33F3N4O3 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 2-[N-[1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethenyl]-4-(pyrrolidin-1-ylmethyl)anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | [H]/N=C(\C(=O)NCC(F)(F)F)N(C(=C)c1cc(C(C)C)c(OC)cc1O)c1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C27H33F3N4O3/c1-17(2)21-13-22(23(35)14-24(21)37-4)18(3)34(25(31)26(36)32-16-27(28,29)30)20-9-7-19(8-10-20)15-33-11-5-6-12-33/h7-10,13-14,17,31,35H,3,5-6,11-12,15-16H2,1-2,4H3,(H,32,36)/b31-25+ |
| InChIKey | XJSGFQIJZPZANX-QCKNELIISA-N |
| XLogP | 5.25 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|