C19H22FN3O3 — CID 89098401
2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-(2-fluorocyclohexa-1,3-dien-1-yl)amino]-2-iminoacetamide (PubChem CID 89098401) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-(2-fluorocyclohexa-1,3-dien-1-yl)amino]-2-iminoacetamide.
| Compound Name | 2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-(2-fluorocyclohexa-1,3-dien-1-yl)amino]-2-iminoacetamide |
|---|---|
| PubChem CID | 89098401 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-(2-fluorocyclohexa-1,3-dien-1-yl)amino]-2-iminoacetamide |
| SMILES | [H]/N=C(\C(N)=O)N(C(=C)c1cc(C(C)C)c(O)cc1O)C1=C(F)C=CCC1 |
| InChI | InChI=1S/C19H22FN3O3/c1-10(2)12-8-13(17(25)9-16(12)24)11(3)23(18(21)19(22)26)15-7-5-4-6-14(15)20/h4,6,8-10,21,24-25H,3,5,7H2,1-2H3,(H2,22,26)/b21-18+ |
| InChIKey | LOBVFFSQAKQZKG-DYTRJAOYSA-N |
| XLogP | 3.49 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|