C29H41F3N6O3 — CID 89098408
(2Z)-2-[4-[[2-[ethyl(methyl)amino]ethyl-methylamino]methyl]-N-[1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethenyl]anilino]-2-hydrazinylidene-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 89098408) has the molecular formula C29H41F3N6O3 and a molecular weight of 578.68 g/mol. Its IUPAC name is (2Z)-2-[4-[[2-[ethyl(methyl)amino]ethyl-methylamino]methyl]-N-[1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethenyl]anilino]-2-hydrazinylidene-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | (2Z)-2-[4-[[2-[ethyl(methyl)amino]ethyl-methylamino]methyl]-N-[1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethenyl]anilino]-2-hydrazinylidene-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 89098408 |
| Molecular Formula | C29H41F3N6O3 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | (2Z)-2-[4-[[2-[ethyl(methyl)amino]ethyl-methylamino]methyl]-N-[1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethenyl]anilino]-2-hydrazinylidene-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C=C(c1cc(C(C)C)c(OC)cc1O)N(/C(=N\N)C(=O)NCC(F)(F)F)c1ccc(CN(C)CCN(C)CC)cc1 |
| InChI | InChI=1S/C29H41F3N6O3/c1-8-36(5)13-14-37(6)17-21-9-11-22(12-10-21)38(27(35-33)28(40)34-18-29(30,31)32)20(4)24-15-23(19(2)3)26(41-7)16-25(24)39/h9-12,15-16,19,39H,4,8,13-14,17-18,33H2,1-3,5-7H3,(H,34,40)/b35-27- |
| InChIKey | VMYIRIDVEQTAMR-LSWMGQQCSA-N |
| XLogP | 4.34 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|