C25H35F3N4O4 — CID 89098430
2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-(4-morpholin-4-ylcyclohexyl)amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 89098430) has the molecular formula C25H35F3N4O4 and a molecular weight of 512.57 g/mol. Its IUPAC name is 2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-(4-morpholin-4-ylcyclohexyl)amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-(4-morpholin-4-ylcyclohexyl)amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 89098430 |
| Molecular Formula | C25H35F3N4O4 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 2-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl-(4-morpholin-4-ylcyclohexyl)amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | [H]/N=C(\C(=O)NCC(F)(F)F)N(C(=C)c1cc(C(C)C)c(O)cc1O)C1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C25H35F3N4O4/c1-15(2)19-12-20(22(34)13-21(19)33)16(3)32(23(29)24(35)30-14-25(26,27)28)18-6-4-17(5-7-18)31-8-10-36-11-9-31/h12-13,15,17-18,29,33-34H,3-11,14H2,1-2H3,(H,30,35)/b29-23+ |
| InChIKey | PNLIIJRWOCKAGD-BYNJWEBRSA-N |
| XLogP | 3.79 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|