C26H35FN4O3 — CID 89098438
N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-fluorocyclohexa-1,3-dien-1-yl]-2-oxoethanimidamide (PubChem CID 89098438) has the molecular formula C26H35FN4O3 and a molecular weight of 470.59 g/mol. Its IUPAC name is N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-fluorocyclohexa-1,3-dien-1-yl]-2-oxoethanimidamide.
| Compound Name | N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-fluorocyclohexa-1,3-dien-1-yl]-2-oxoethanimidamide |
|---|---|
| PubChem CID | 89098438 |
| Molecular Formula | C26H35FN4O3 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-fluorocyclohexa-1,3-dien-1-yl]-2-oxoethanimidamide |
| SMILES | [H]/N=C(\C=O)N(C(=C)c1cc(C(C)C)c(O)cc1O)C1=CC(F)=C(CN2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C26H35FN4O3/c1-5-29-8-10-30(11-9-29)15-19-6-7-20(12-23(19)27)31(26(28)16-32)18(4)22-13-21(17(2)3)24(33)14-25(22)34/h12-14,16-17,28,33-34H,4-11,15H2,1-3H3/b28-26+ |
| InChIKey | MMVZLVFXQNBBPG-BYCLXTJYSA-N |
| XLogP | 4.21 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|