C25H33FN4O3 — CID 89098441
N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-N-[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-2-oxoethanimidamide (PubChem CID 89098441) has the molecular formula C25H33FN4O3 and a molecular weight of 456.56 g/mol. Its IUPAC name is N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-N-[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-2-oxoethanimidamide.
| Compound Name | N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-N-[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-2-oxoethanimidamide |
|---|---|
| PubChem CID | 89098441 |
| Molecular Formula | C25H33FN4O3 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | N-[1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]-N-[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]cyclohexa-1,3-dien-1-yl]-2-oxoethanimidamide |
| SMILES | [H]/N=C(\C=O)N(C(=C)c1cc(C(C)C)c(O)cc1O)C1=CC(F)=C(CN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C25H33FN4O3/c1-16(2)20-12-21(24(33)13-23(20)32)17(3)30(25(27)15-31)19-6-5-18(22(26)11-19)14-29-9-7-28(4)8-10-29/h11-13,15-16,27,32-33H,3,5-10,14H2,1-2,4H3/b27-25+ |
| InChIKey | ACYWYYBNAYITLO-IMVLJIQESA-N |
| XLogP | 3.82 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|