C27H38FN5O3 — CID 89098443
N-[1-amino-1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethyl]-N-[3-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]-2-oxoethanimidamide (PubChem CID 89098443) has the molecular formula C27H38FN5O3 and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[1-amino-1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethyl]-N-[3-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]-2-oxoethanimidamide.
| Compound Name | N-[1-amino-1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethyl]-N-[3-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]-2-oxoethanimidamide |
|---|---|
| PubChem CID | 89098443 |
| Molecular Formula | C27H38FN5O3 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | N-[1-amino-1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethyl]-N-[3-fluoro-4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]-2-oxoethanimidamide |
| SMILES | [H]/N=C(\C=O)N(c1ccc(CN2CCN(C(C)C)CC2)c(F)c1)C(C)(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C27H38FN5O3/c1-17(2)21-13-22(25(36)14-24(21)35)27(5,30)33(26(29)16-34)20-7-6-19(23(28)12-20)15-31-8-10-32(11-9-31)18(3)4/h6-7,12-14,16-18,29,35-36H,8-11,15,30H2,1-5H3/b29-26+ |
| InChIKey | BLWURNTZXYLDQP-PBBVDAKRSA-N |
| XLogP | 3.70 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|