About 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal
7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal (PubChem CID 89098544) has the molecular formula C17H21NO3
and a molecular weight of 287.36 g/mol. Its IUPAC name is 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal.
Molecular Properties
| Compound Name | 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal |
| PubChem CID | 89098544 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal |
| SMILES | COc1ccccc1-c1cnc(CCCCCCC=O)o1 |
| InChI | InChI=1S/C17H21NO3/c1-20-15-10-7-6-9-14(15)16-13-18-17(21-16)11-5-3-2-4-8-12-19/h6-7,9-10,12-13H,2-5,8,11H2,1H3 |
| InChIKey | PNVUVCJGFSUKSG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal?
The IUPAC name of 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal (CID 89098544) is 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal.
What is the SMILES notation for 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal?
The canonical SMILES for 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal is COc1ccccc1-c1cnc(CCCCCCC=O)o1.
What is the InChIKey of 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal?
The InChIKey is PNVUVCJGFSUKSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3/c1-20-15-10-7-6-9-14(15)16-13-18-17(21-16)11-5-3-2-4-8-12-19/h6-7,9-10,12-13H,2-5,8,11H2,1H3.
What are the key properties of 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal?
7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal has a molecular weight of 287.36 g/mol, XLogP of 4.04, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[5-(2-methoxyphenyl)-1,3-oxazol-2-yl]heptanal is sourced from PubChem (CID 89098544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).