C18H32N2 — CID 89098721
5-[(E)-4-ethenyl-5-methyloct-2-en-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 89098721) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 5-[(E)-4-ethenyl-5-methyloct-2-en-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-[(E)-4-ethenyl-5-methyloct-2-en-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 89098721 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 5-[(E)-4-ethenyl-5-methyloct-2-en-3-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C=CC(/C(=C\C)C1CNC2NCCC2C1)C(C)CCC |
| InChI | InChI=1S/C18H32N2/c1-5-8-13(4)16(6-2)17(7-3)15-11-14-9-10-19-18(14)20-12-15/h6-7,13-16,18-20H,2,5,8-12H2,1,3-4H3/b17-7- |
| InChIKey | UITDODGOGVHAAX-IDUWFGFVSA-N |
| XLogP | 3.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|