About (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine
(Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine (PubChem CID 89098775) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine.
Molecular Properties
| Compound Name | (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine |
| PubChem CID | 89098775 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine |
| SMILES | C=C(C)/C=C\C(=N/N)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-7(2)5-6-9(11-10)8(3)4/h5-6,8H,1,10H2,2-4H3/b6-5-,11-9+ |
| InChIKey | VELCFERICRTMAN-QEYVUMQQSA-N |
| XLogP | 2.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine?
The IUPAC name of (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine (CID 89098775) is (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine.
What is the SMILES notation for (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine?
The canonical SMILES for (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine is C=C(C)/C=C\C(=N/N)C(C)C.
What is the InChIKey of (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine?
The InChIKey is VELCFERICRTMAN-QEYVUMQQSA-N. The full InChI is InChI=1S/C9H16N2/c1-7(2)5-6-9(11-10)8(3)4/h5-6,8H,1,10H2,2-4H3/b6-5-,11-9+.
What are the key properties of (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine?
(Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine has a molecular weight of 152.24 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-[(4Z)-2,6-dimethylhepta-4,6-dien-3-ylidene]hydrazine is sourced from PubChem (CID 89098775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).