C10H15N — CID 89098818
(3E,5Z)-N-ethenyl-N-methylhepta-1,3,5-trien-4-amine (PubChem CID 89098818) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (3E,5Z)-N-ethenyl-N-methylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-N-ethenyl-N-methylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 89098818 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3E,5Z)-N-ethenyl-N-methylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)N(C)C=C |
| InChI | InChI=1S/C10H15N/c1-5-8-10(9-6-2)11(4)7-3/h5-9H,1,3H2,2,4H3/b9-6-,10-8+ |
| InChIKey | YMIIGACYTGHWNV-NULKZJHKSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|