About (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine
(1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine (PubChem CID 89098949) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine |
| PubChem CID | 89098949 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)[C@@H](N)C1CC=CS1 |
| InChI | InChI=1S/C9H17NS/c1-9(2,3)8(10)7-5-4-6-11-7/h4,6-8H,5,10H2,1-3H3/t7?,8-/m0/s1 |
| InChIKey | FWWXEWQNEGPCJU-MQWKRIRWSA-N |
| XLogP | 2.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine?
The IUPAC name of (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine (CID 89098949) is (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine.
What is the SMILES notation for (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine?
The canonical SMILES for (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine is CC(C)(C)[C@@H](N)C1CC=CS1.
What is the InChIKey of (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine?
The InChIKey is FWWXEWQNEGPCJU-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H17NS/c1-9(2,3)8(10)7-5-4-6-11-7/h4,6-8H,5,10H2,1-3H3/t7?,8-/m0/s1.
What are the key properties of (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine?
(1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine has a molecular weight of 171.31 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2,3-dihydrothiophen-2-yl)-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 89098949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).