C6H6F3NS — CID 89098959
1-(2,3-dihydrothiophen-2-yl)-2,2,2-trifluoroethanimine (PubChem CID 89098959) has the molecular formula C6H6F3NS and a molecular weight of 181.18 g/mol. Its IUPAC name is 1-(2,3-dihydrothiophen-2-yl)-2,2,2-trifluoroethanimine.
| Compound Name | 1-(2,3-dihydrothiophen-2-yl)-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 89098959 |
| Molecular Formula | C6H6F3NS |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 1-(2,3-dihydrothiophen-2-yl)-2,2,2-trifluoroethanimine |
| SMILES | [H]/N=C(\C1CC=CS1)C(F)(F)F |
| InChI | InChI=1S/C6H6F3NS/c7-6(8,9)5(10)4-2-1-3-11-4/h1,3-4,10H,2H2/b10-5+ |
| InChIKey | MXKQNNIVAQDIEO-BJMVGYQFSA-N |
| XLogP | 2.59 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|