About N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine
N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine (PubChem CID 89098985) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine |
| PubChem CID | 89098985 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine |
| SMILES | CCC(NC)C1CC=C(C)O1 |
| InChI | InChI=1S/C9H17NO/c1-4-8(10-3)9-6-5-7(2)11-9/h5,8-10H,4,6H2,1-3H3 |
| InChIKey | WUGKUKWFMFOEDN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine?
The IUPAC name of N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine (CID 89098985) is N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine.
What is the SMILES notation for N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine?
The canonical SMILES for N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine is CCC(NC)C1CC=C(C)O1.
What is the InChIKey of N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine?
The InChIKey is WUGKUKWFMFOEDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-4-8(10-3)9-6-5-7(2)11-9/h5,8-10H,4,6H2,1-3H3.
What are the key properties of N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine?
N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine has a molecular weight of 155.24 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(5-methyl-2,3-dihydrofuran-2-yl)propan-1-amine is sourced from PubChem (CID 89098985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).