About (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol
(2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol (PubChem CID 89098989) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol |
| PubChem CID | 89098989 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol |
| SMILES | C=C/C(=C\C=C(/C)C(N)CC)CO |
| InChI | InChI=1S/C11H19NO/c1-4-10(8-13)7-6-9(3)11(12)5-2/h4,6-7,11,13H,1,5,8,12H2,2-3H3/b9-6+,10-7+ |
| InChIKey | GUDFZZQERYGYMU-KZZDLZNXSA-N |
| XLogP | 1.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol?
The IUPAC name of (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol (CID 89098989) is (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol.
What is the SMILES notation for (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol?
The canonical SMILES for (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol is C=C/C(=C\C=C(/C)C(N)CC)CO.
What is the InChIKey of (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol?
The InChIKey is GUDFZZQERYGYMU-KZZDLZNXSA-N. The full InChI is InChI=1S/C11H19NO/c1-4-10(8-13)7-6-9(3)11(12)5-2/h4,6-7,11,13H,1,5,8,12H2,2-3H3/b9-6+,10-7+.
What are the key properties of (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol?
(2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol has a molecular weight of 181.28 g/mol, XLogP of 1.77, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-6-amino-2-ethenyl-5-methylocta-2,4-dien-1-ol is sourced from PubChem (CID 89098989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).