C9H14FN — CID 89099064
(3E,5E)-6-fluoro-3-methylocta-3,5,7-trien-1-amine (PubChem CID 89099064) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is (3E,5E)-6-fluoro-3-methylocta-3,5,7-trien-1-amine.
| Compound Name | (3E,5E)-6-fluoro-3-methylocta-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 89099064 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (3E,5E)-6-fluoro-3-methylocta-3,5,7-trien-1-amine |
| SMILES | C=C/C(F)=C\C=C(/C)CCN |
| InChI | InChI=1S/C9H14FN/c1-3-9(10)5-4-8(2)6-7-11/h3-5H,1,6-7,11H2,2H3/b8-4+,9-5+ |
| InChIKey | JSPQIGPQXBNFOK-KBXRYBNXSA-N |
| XLogP | 2.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|