C12H17N — CID 89099110
(3Z,5Z)-8,8,9-trimethyl-7-methylidene-2H-azonine (PubChem CID 89099110) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (3Z,5Z)-8,8,9-trimethyl-7-methylidene-2H-azonine.
| Compound Name | (3Z,5Z)-8,8,9-trimethyl-7-methylidene-2H-azonine |
|---|---|
| PubChem CID | 89099110 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (3Z,5Z)-8,8,9-trimethyl-7-methylidene-2H-azonine |
| SMILES | C=C1/C=C\C=C/C/N=C(/C)C1(C)C |
| InChI | InChI=1S/C12H17N/c1-10-8-6-5-7-9-13-11(2)12(10,3)4/h5-8H,1,9H2,2-4H3/b7-5-,8-6-,13-11- |
| InChIKey | WEUKPGGCYISLMG-CJGUMKJGSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |