C11H16O — CID 89099143
7-methyl-2-methylidene-3,4,4a,7,8,8a-hexahydrochromene (PubChem CID 89099143) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 7-methyl-2-methylidene-3,4,4a,7,8,8a-hexahydrochromene.
| Compound Name | 7-methyl-2-methylidene-3,4,4a,7,8,8a-hexahydrochromene |
|---|---|
| PubChem CID | 89099143 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 7-methyl-2-methylidene-3,4,4a,7,8,8a-hexahydrochromene |
| SMILES | C=C1CCC2C=CC(C)CC2O1 |
| InChI | InChI=1S/C11H16O/c1-8-3-5-10-6-4-9(2)12-11(10)7-8/h3,5,8,10-11H,2,4,6-7H2,1H3 |
| InChIKey | QIRNKYNRVOZIDK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|