C11H18O — CID 89099155
5-methyl-2-methylidene-3,4,4a,5,6,7,8,8a-octahydrochromene (PubChem CID 89099155) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 5-methyl-2-methylidene-3,4,4a,5,6,7,8,8a-octahydrochromene.
| Compound Name | 5-methyl-2-methylidene-3,4,4a,5,6,7,8,8a-octahydrochromene |
|---|---|
| PubChem CID | 89099155 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 5-methyl-2-methylidene-3,4,4a,5,6,7,8,8a-octahydrochromene |
| SMILES | C=C1CCC2C(C)CCCC2O1 |
| InChI | InChI=1S/C11H18O/c1-8-4-3-5-11-10(8)7-6-9(2)12-11/h8,10-11H,2-7H2,1H3 |
| InChIKey | QJQLVADGIBBZNZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |