C11H16O2 — CID 89099291
2-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxymethyl]oxirane (PubChem CID 89099291) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxymethyl]oxirane.
| Compound Name | 2-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 89099291 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxymethyl]oxirane |
| SMILES | C=C(C)/C=C\C(=C/C)OCC1CO1 |
| InChI | InChI=1S/C11H16O2/c1-4-10(6-5-9(2)3)12-7-11-8-13-11/h4-6,11H,2,7-8H2,1,3H3/b6-5-,10-4+ |
| InChIKey | HECWSJRECMLCIN-QYONPMAVSA-N |
| XLogP | 2.44 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|