C17H16N2O4 — CID 89099413
4,7-dimethyl-2-(4-methyl-3-nitrosophenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 89099413) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 4,7-dimethyl-2-(4-methyl-3-nitrosophenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 4,7-dimethyl-2-(4-methyl-3-nitrosophenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 89099413 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4,7-dimethyl-2-(4-methyl-3-nitrosophenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)C3C(C2=O)C2(C)C=CC3(C)O2)cc1N=O |
| InChI | InChI=1S/C17H16N2O4/c1-9-4-5-10(8-11(9)18-22)19-14(20)12-13(15(19)21)17(3)7-6-16(12,2)23-17/h4-8,12-13H,1-3H3 |
| InChIKey | WYIVKVAZAKQLPG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|