C20H17F3N2O5 — CID 89099438
4-[(3aR,7aS)-4,7-dimethyl-5-(methylperoxymethyl)-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 89099438) has the molecular formula C20H17F3N2O5 and a molecular weight of 422.36 g/mol. Its IUPAC name is 4-[(3aR,7aS)-4,7-dimethyl-5-(methylperoxymethyl)-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,7aS)-4,7-dimethyl-5-(methylperoxymethyl)-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 89099438 |
| Molecular Formula | C20H17F3N2O5 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 4-[(3aR,7aS)-4,7-dimethyl-5-(methylperoxymethyl)-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | COOCC1=CC2(C)OC1(C)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C20H17F3N2O5/c1-18-7-11(9-29-28-3)19(2,30-18)15-14(18)16(26)25(17(15)27)12-5-4-10(8-24)13(6-12)20(21,22)23/h4-7,14-15H,9H2,1-3H3/t14-,15+,18?,19?/m1/s1 |
| InChIKey | DFNVGXUWBHIDSA-OMGLFLRBSA-N |
| XLogP | 2.75 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|