C12H25NO2 — CID 89099495
N-(cyclohexylmethyl)-3,3-dimethoxypropan-1-amine (PubChem CID 89099495) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3,3-dimethoxypropan-1-amine.
| Compound Name | N-(cyclohexylmethyl)-3,3-dimethoxypropan-1-amine |
|---|---|
| PubChem CID | 89099495 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | N-(cyclohexylmethyl)-3,3-dimethoxypropan-1-amine |
| SMILES | COC(CCNCC1CCCCC1)OC |
| InChI | InChI=1S/C12H25NO2/c1-14-12(15-2)8-9-13-10-11-6-4-3-5-7-11/h11-13H,3-10H2,1-2H3 |
| InChIKey | PZTLMGVQUXRMJL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|