C32H35FN2O3 — CID 89099538
2-[(4R,6S)-6-[(E)-2-[6-(4-fluorophenyl)-4-propan-2-yl-3,15-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 89099538) has the molecular formula C32H35FN2O3 and a molecular weight of 514.64 g/mol. Its IUPAC name is 2-[(4R,6S)-6-[(E)-2-[6-(4-fluorophenyl)-4-propan-2-yl-3,15-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(4R,6S)-6-[(E)-2-[6-(4-fluorophenyl)-4-propan-2-yl-3,15-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 89099538 |
| Molecular Formula | C32H35FN2O3 |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 2-[(4R,6S)-6-[(E)-2-[6-(4-fluorophenyl)-4-propan-2-yl-3,15-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1/C=C/[C@@H]1C[C@H](CC=O)OC(C)(C)O1)CCCc1cccnc1-2 |
| InChI | InChI=1S/C32H35FN2O3/c1-20(2)29-27(15-14-24-19-25(16-18-36)38-32(3,4)37-24)28(21-10-12-23(33)13-11-21)26-9-5-7-22-8-6-17-34-30(22)31(26)35-29/h6,8,10-15,17-18,20,24-25H,5,7,9,16,19H2,1-4H3/b15-14+/t24-,25+/m1/s1 |
| InChIKey | IICSOZQTGYDKFJ-AWRZONTFSA-N |
| XLogP | 7.07 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|