C25H46F6O2 — CID 89099653
3,3,4-triethyl-4-(2-ethyl-1,1-difluoro-2-methylbutoxy)-1,1,2,2-tetrafluoro-1-(3-methylpentan-3-yloxy)hexane (PubChem CID 89099653) has the molecular formula C25H46F6O2 and a molecular weight of 492.63 g/mol. Its IUPAC name is 3,3,4-triethyl-4-(2-ethyl-1,1-difluoro-2-methylbutoxy)-1,1,2,2-tetrafluoro-1-(3-methylpentan-3-yloxy)hexane.
| Compound Name | 3,3,4-triethyl-4-(2-ethyl-1,1-difluoro-2-methylbutoxy)-1,1,2,2-tetrafluoro-1-(3-methylpentan-3-yloxy)hexane |
|---|---|
| PubChem CID | 89099653 |
| Molecular Formula | C25H46F6O2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | 3,3,4-triethyl-4-(2-ethyl-1,1-difluoro-2-methylbutoxy)-1,1,2,2-tetrafluoro-1-(3-methylpentan-3-yloxy)hexane |
| SMILES | CCC(C)(CC)OC(F)(F)C(F)(F)C(CC)(CC)C(CC)(CC)OC(F)(F)C(C)(CC)CC |
| InChI | InChI=1S/C25H46F6O2/c1-11-19(9,12-2)24(28,29)33-22(17-7,18-8)21(15-5,16-6)23(26,27)25(30,31)32-20(10,13-3)14-4/h11-18H2,1-10H3 |
| InChIKey | PUSDRIIDGJQZDT-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|