C22H28N2O5S — CID 89099784
3-[[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethyl-2,3-dihydroindol-5-yl]oxy]propane-1-sulfonic acid (PubChem CID 89099784) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is 3-[[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethyl-2,3-dihydroindol-5-yl]oxy]propane-1-sulfonic acid.
| Compound Name | 3-[[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethyl-2,3-dihydroindol-5-yl]oxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89099784 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-[[3-(2-amino-2-oxoethyl)-1-benzyl-2-ethyl-2,3-dihydroindol-5-yl]oxy]propane-1-sulfonic acid |
| SMILES | CCC1C(CC(N)=O)c2cc(OCCCS(=O)(=O)O)ccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O5S/c1-2-20-19(14-22(23)25)18-13-17(29-11-6-12-30(26,27)28)9-10-21(18)24(20)15-16-7-4-3-5-8-16/h3-5,7-10,13,19-20H,2,6,11-12,14-15H2,1H3,(H2,23,25)(H,26,27,28) |
| InChIKey | URDIEIMQDOVSCC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|