C28H46N2O8 — CID 89100032
ethyl 2-[[3-[[[2-(2-ethoxy-2-oxoethyl)-5-oxopentanoyl]amino]methyl]-3,5,5-trimethylcyclohexyl]carbamoyl]-6-oxohexanoate (PubChem CID 89100032) has the molecular formula C28H46N2O8 and a molecular weight of 538.68 g/mol. Its IUPAC name is ethyl 2-[[3-[[[2-(2-ethoxy-2-oxoethyl)-5-oxopentanoyl]amino]methyl]-3,5,5-trimethylcyclohexyl]carbamoyl]-6-oxohexanoate.
| Compound Name | ethyl 2-[[3-[[[2-(2-ethoxy-2-oxoethyl)-5-oxopentanoyl]amino]methyl]-3,5,5-trimethylcyclohexyl]carbamoyl]-6-oxohexanoate |
|---|---|
| PubChem CID | 89100032 |
| Molecular Formula | C28H46N2O8 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | ethyl 2-[[3-[[[2-(2-ethoxy-2-oxoethyl)-5-oxopentanoyl]amino]methyl]-3,5,5-trimethylcyclohexyl]carbamoyl]-6-oxohexanoate |
| SMILES | CCOC(=O)CC(CCC=O)C(=O)NCC1(C)CC(NC(=O)C(CCCC=O)C(=O)OCC)CC(C)(C)C1 |
| InChI | InChI=1S/C28H46N2O8/c1-6-37-23(33)15-20(11-10-14-32)24(34)29-19-28(5)17-21(16-27(3,4)18-28)30-25(35)22(12-8-9-13-31)26(36)38-7-2/h13-14,20-22H,6-12,15-19H2,1-5H3,(H,29,34)(H,30,35) |
| InChIKey | AERDDTRPZQIMKB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|