C21H20N4O5S — CID 89100156
2-cyano-3-[3-ethyl-5-[2-[3-[(2-hydroxy-2-methylpropanoyl)amino]anilino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enoic acid (PubChem CID 89100156) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-cyano-3-[3-ethyl-5-[2-[3-[(2-hydroxy-2-methylpropanoyl)amino]anilino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[3-ethyl-5-[2-[3-[(2-hydroxy-2-methylpropanoyl)amino]anilino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enoic acid |
|---|---|
| PubChem CID | 89100156 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-cyano-3-[3-ethyl-5-[2-[3-[(2-hydroxy-2-methylpropanoyl)amino]anilino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enoic acid |
| SMILES | CCn1c(=C=C(C#N)C(=O)O)sc(=C=CNc2cccc(NC(=O)C(C)(C)O)c2)c1=O |
| InChI | InChI=1S/C21H20N4O5S/c1-4-25-17(10-13(12-22)19(27)28)31-16(18(25)26)8-9-23-14-6-5-7-15(11-14)24-20(29)21(2,3)30/h5-7,9,11,23,30H,4H2,1-3H3,(H,24,29)(H,27,28) |
| InChIKey | AJYFNJXFDMAABS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|