C27H27F3N6O2S — CID 89100204
2-cyano-N-(cyanomethyl)-3-[3-ethyl-4-oxo-5-[2-[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]anilino]ethenylidene]-1,3-thiazolidin-2-ylidene]prop-2-enamide (PubChem CID 89100204) has the molecular formula C27H27F3N6O2S and a molecular weight of 556.61 g/mol. Its IUPAC name is 2-cyano-N-(cyanomethyl)-3-[3-ethyl-4-oxo-5-[2-[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]anilino]ethenylidene]-1,3-thiazolidin-2-ylidene]prop-2-enamide.
| Compound Name | 2-cyano-N-(cyanomethyl)-3-[3-ethyl-4-oxo-5-[2-[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]anilino]ethenylidene]-1,3-thiazolidin-2-ylidene]prop-2-enamide |
|---|---|
| PubChem CID | 89100204 |
| Molecular Formula | C27H27F3N6O2S |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-cyano-N-(cyanomethyl)-3-[3-ethyl-4-oxo-5-[2-[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]anilino]ethenylidene]-1,3-thiazolidin-2-ylidene]prop-2-enamide |
| SMILES | CCn1c(=C=C(C#N)C(=O)NCC#N)sc(=C=CNc2cccc(CCN3CCC(C(F)(F)F)CC3)c2)c1=O |
| InChI | InChI=1S/C27H27F3N6O2S/c1-2-36-24(17-20(18-32)25(37)34-12-10-31)39-23(26(36)38)6-11-33-22-5-3-4-19(16-22)7-13-35-14-8-21(9-15-35)27(28,29)30/h3-5,11,16,21,33H,2,7-9,12-15H2,1H3,(H,34,37) |
| InChIKey | GSQJMEXOIUSWDA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 113.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|