C25H25N7O4S — CID 89100210
2-cyano-N-(cyanomethyl)-3-[3-ethyl-5-[2-[3-[(2-morpholin-4-ylacetyl)amino]anilino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enamide (PubChem CID 89100210) has the molecular formula C25H25N7O4S and a molecular weight of 519.59 g/mol. Its IUPAC name is 2-cyano-N-(cyanomethyl)-3-[3-ethyl-5-[2-[3-[(2-morpholin-4-ylacetyl)amino]anilino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enamide.
| Compound Name | 2-cyano-N-(cyanomethyl)-3-[3-ethyl-5-[2-[3-[(2-morpholin-4-ylacetyl)amino]anilino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enamide |
|---|---|
| PubChem CID | 89100210 |
| Molecular Formula | C25H25N7O4S |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 2-cyano-N-(cyanomethyl)-3-[3-ethyl-5-[2-[3-[(2-morpholin-4-ylacetyl)amino]anilino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enamide |
| SMILES | CCn1c(=C=C(C#N)C(=O)NCC#N)sc(=C=CNc2cccc(NC(=O)CN3CCOCC3)c2)c1=O |
| InChI | InChI=1S/C25H25N7O4S/c1-2-32-23(14-18(16-27)24(34)29-9-7-26)37-21(25(32)35)6-8-28-19-4-3-5-20(15-19)30-22(33)17-31-10-12-36-13-11-31/h3-5,8,15,28H,2,9-13,17H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | KYEVMNGLLRYOSQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 152.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|