C24H27N5O4S — CID 89100362
tert-butyl N-[3-[2-[2-[2-cyano-3-(ethylamino)-3-oxoprop-1-enylidene]-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]ethenylamino]phenyl]carbamate (PubChem CID 89100362) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[2-[2-cyano-3-(ethylamino)-3-oxoprop-1-enylidene]-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]ethenylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[2-[2-cyano-3-(ethylamino)-3-oxoprop-1-enylidene]-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]ethenylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 89100362 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | tert-butyl N-[3-[2-[2-[2-cyano-3-(ethylamino)-3-oxoprop-1-enylidene]-3-ethyl-4-oxo-1,3-thiazolidin-5-ylidene]ethenylamino]phenyl]carbamate |
| SMILES | CCNC(=O)C(=C=c1sc(=C=CNc2cccc(NC(=O)OC(C)(C)C)c2)c(=O)n1CC)C#N |
| InChI | InChI=1S/C24H27N5O4S/c1-6-26-21(30)16(15-25)13-20-29(7-2)22(31)19(34-20)11-12-27-17-9-8-10-18(14-17)28-23(32)33-24(3,4)5/h8-10,12,14,27H,6-7H2,1-5H3,(H,26,30)(H,28,32) |
| InChIKey | MQUCSPUOLJBUIL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|