About 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole]
1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole] (PubChem CID 89100503) has the molecular formula C25H21FN2O2
and a molecular weight of 400.45 g/mol. Its IUPAC name is 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole].
Molecular Properties
| Compound Name | 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole] |
| PubChem CID | 89100503 |
| Molecular Formula | C25H21FN2O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole] |
| SMILES | CC1(C)c2ccccc2N(Cc2ccc(F)cc2)C12C=Cc1cc(N=O)ccc1O2 |
| InChI | InChI=1S/C25H21FN2O2/c1-24(2)21-5-3-4-6-22(21)28(16-17-7-9-19(26)10-8-17)25(24)14-13-18-15-20(27-29)11-12-23(18)30-25/h3-15H,16H2,1-2H3 |
| InChIKey | ZZMDNEHHVXVAKM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole]?
The IUPAC name of 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole] (CID 89100503) is 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole].
What is the SMILES notation for 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole]?
The canonical SMILES for 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole] is CC1(C)c2ccccc2N(Cc2ccc(F)cc2)C12C=Cc1cc(N=O)ccc1O2.
What is the InChIKey of 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole]?
The InChIKey is ZZMDNEHHVXVAKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21FN2O2/c1-24(2)21-5-3-4-6-22(21)28(16-17-7-9-19(26)10-8-17)25(24)14-13-18-15-20(27-29)11-12-23(18)30-25/h3-15H,16H2,1-2H3.
What are the key properties of 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole]?
1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole] has a molecular weight of 400.45 g/mol, XLogP of 6.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[(4-fluorophenyl)methyl]-3',3'-dimethyl-6-nitrosospiro[chromene-2,2'-indole] is sourced from PubChem (CID 89100503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).