C30H40N4O2 — CID 89100788
(2S)-1-[(3S)-3-cyclohexyl-3-[[(2S)-2-(methylamino)propanoyl]amino]prop-1-en-2-yl]-N-(2-phenylphenyl)pyrrolidine-2-carboxamide (PubChem CID 89100788) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is (2S)-1-[(3S)-3-cyclohexyl-3-[[(2S)-2-(methylamino)propanoyl]amino]prop-1-en-2-yl]-N-(2-phenylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(3S)-3-cyclohexyl-3-[[(2S)-2-(methylamino)propanoyl]amino]prop-1-en-2-yl]-N-(2-phenylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89100788 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | (2S)-1-[(3S)-3-cyclohexyl-3-[[(2S)-2-(methylamino)propanoyl]amino]prop-1-en-2-yl]-N-(2-phenylphenyl)pyrrolidine-2-carboxamide |
| SMILES | C=C([C@@H](NC(=O)[C@H](C)NC)C1CCCCC1)N1CCC[C@H]1C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C30H40N4O2/c1-21(31-3)29(35)33-28(24-15-8-5-9-16-24)22(2)34-20-12-19-27(34)30(36)32-26-18-11-10-17-25(26)23-13-6-4-7-14-23/h4,6-7,10-11,13-14,17-18,21,24,27-28,31H,2,5,8-9,12,15-16,19-20H2,1,3H3,(H,32,36)(H,33,35)/t21-,27-,28+/m0/s1 |
| InChIKey | TWIGQOPJLILQRX-YNOBPPCASA-N |
| XLogP | 4.94 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |