C23H21BF4N2O2 — CID 89100801
CID 89100801 (PubChem CID 89100801) has the molecular formula C23H21BF4N2O2 and a molecular weight of 444.24 g/mol.
| Compound Name | CID 89100801 |
|---|---|
| PubChem CID | 89100801 |
| Molecular Formula | C23H21BF4N2O2 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)c2[nH]c(C)c(CCNC(=O)/C(C)=C/c3cc(OC(F)(F)F)ccc3C)c2c1 |
| InChI | InChI=1S/C23H21BF4N2O2/c1-12-4-5-17(32-23(26,27)28)9-15(12)8-13(2)22(31)29-7-6-18-14(3)30-21-19(18)10-16(24)11-20(21)25/h4-5,8-11,30H,6-7H2,1-3H3,(H,29,31)/b13-8+ |
| InChIKey | AXTIFUKZBSEMQA-MDWZMJQESA-N |
| XLogP | 4.38 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|