About N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine
N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine (PubChem CID 89100894) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine |
| PubChem CID | 89100894 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine |
| SMILES | C=C(NCCNC(C)(C)CC)C(C)(C)CC |
| InChI | InChI=1S/C14H30N2/c1-8-13(4,5)12(3)15-10-11-16-14(6,7)9-2/h15-16H,3,8-11H2,1-2,4-7H3 |
| InChIKey | OVVNLCUQUCBEQU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine?
The IUPAC name of N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine (CID 89100894) is N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine?
The canonical SMILES for N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine is C=C(NCCNC(C)(C)CC)C(C)(C)CC.
What is the InChIKey of N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine?
The InChIKey is OVVNLCUQUCBEQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2/c1-8-13(4,5)12(3)15-10-11-16-14(6,7)9-2/h15-16H,3,8-11H2,1-2,4-7H3.
What are the key properties of N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine?
N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine has a molecular weight of 226.41 g/mol, XLogP of 3.30, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylpent-1-en-2-yl)-N'-(2-methylbutan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 89100894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).