2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid

C10H15NO2 — CID 89101329

IUPAC2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid
SMILESCNC(C)(C(=O)O)C1=CCCC=C1
InChIInChI=1S/C10H15NO2/c1-10(11-2,9(12)13)8-6-4-3-5-7-8/h4,6-7,11H,3,5H2,1-2H3,(H,12,13)
InChIKeyNZQXZZHNKMOYPE-UHFFFAOYSA-N
MW181.23 g/mol
LogP1.33
Rot. Bonds3

About 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid

2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid (PubChem CID 89101329) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid.

Molecular Properties

Compound Name2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid
PubChem CID89101329
Molecular FormulaC10H15NO2
Molecular Weight181.23 g/mol
Exact Mass181.11
IUPAC Name2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid
SMILESCNC(C)(C(=O)O)C1=CCCC=C1
InChIInChI=1S/C10H15NO2/c1-10(11-2,9(12)13)8-6-4-3-5-7-8/h4,6-7,11H,3,5H2,1-2H3,(H,12,13)
InChIKeyNZQXZZHNKMOYPE-UHFFFAOYSA-N
XLogP1.33
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.23
LogP ≤ 51.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid?
The IUPAC name of 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid (CID 89101329) is 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid.
What is the SMILES notation for 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid?
The canonical SMILES for 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid is CNC(C)(C(=O)O)C1=CCCC=C1.
What is the InChIKey of 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid?
The InChIKey is NZQXZZHNKMOYPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-10(11-2,9(12)13)8-6-4-3-5-7-8/h4,6-7,11H,3,5H2,1-2H3,(H,12,13).
What are the key properties of 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid?
2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid has a molecular weight of 181.23 g/mol, XLogP of 1.33, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)propanoic acid is sourced from PubChem (CID 89101329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).