About 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane
2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane (PubChem CID 89101597) has the molecular formula C8H16BNO2
and a molecular weight of 169.03 g/mol. Its IUPAC name is 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane.
Molecular Properties
| Compound Name | 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane |
| PubChem CID | 89101597 |
| Molecular Formula | C8H16BNO2 |
| Molecular Weight | 169.03 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane |
| SMILES | CN1CCOB(C2CC2)OCC1 |
| InChI | InChI=1S/C8H16BNO2/c1-10-4-6-11-9(8-2-3-8)12-7-5-10/h8H,2-7H2,1H3 |
| InChIKey | BSVOKTUANZTQEL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.03 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane?
The IUPAC name of 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane (CID 89101597) is 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane.
What is the SMILES notation for 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane?
The canonical SMILES for 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane is CN1CCOB(C2CC2)OCC1.
What is the InChIKey of 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane?
The InChIKey is BSVOKTUANZTQEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16BNO2/c1-10-4-6-11-9(8-2-3-8)12-7-5-10/h8H,2-7H2,1H3.
What are the key properties of 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane?
2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane has a molecular weight of 169.03 g/mol, XLogP of 0.62, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-6-methyl-1,3,6,2-dioxazaborocane is sourced from PubChem (CID 89101597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).