About 2-cyclopropyl-1,3,6,2-dioxazaborocane
2-cyclopropyl-1,3,6,2-dioxazaborocane (PubChem CID 89101629) has the molecular formula C7H14BNO2
and a molecular weight of 155.01 g/mol. Its IUPAC name is 2-cyclopropyl-1,3,6,2-dioxazaborocane.
Molecular Properties
| Compound Name | 2-cyclopropyl-1,3,6,2-dioxazaborocane |
| PubChem CID | 89101629 |
| Molecular Formula | C7H14BNO2 |
| Molecular Weight | 155.01 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-cyclopropyl-1,3,6,2-dioxazaborocane |
| SMILES | C1COB(C2CC2)OCCN1 |
| InChI | InChI=1S/C7H14BNO2/c1-2-7(1)8-10-5-3-9-4-6-11-8/h7,9H,1-6H2 |
| InChIKey | GVUVHTDEQGJJLH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.01 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-1,3,6,2-dioxazaborocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1,3,6,2-dioxazaborocane?
The IUPAC name of 2-cyclopropyl-1,3,6,2-dioxazaborocane (CID 89101629) is 2-cyclopropyl-1,3,6,2-dioxazaborocane.
What is the SMILES notation for 2-cyclopropyl-1,3,6,2-dioxazaborocane?
The canonical SMILES for 2-cyclopropyl-1,3,6,2-dioxazaborocane is C1COB(C2CC2)OCCN1.
What is the InChIKey of 2-cyclopropyl-1,3,6,2-dioxazaborocane?
The InChIKey is GVUVHTDEQGJJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BNO2/c1-2-7(1)8-10-5-3-9-4-6-11-8/h7,9H,1-6H2.
What are the key properties of 2-cyclopropyl-1,3,6,2-dioxazaborocane?
2-cyclopropyl-1,3,6,2-dioxazaborocane has a molecular weight of 155.01 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1,3,6,2-dioxazaborocane is sourced from PubChem (CID 89101629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).